About 3-methoxy-N,N-bis(trifluoromethyl)propan-1-amine
3-methoxy-N,N-bis(trifluoromethyl)propan-1-amine (PubChem CID 59366578) has the molecular formula C6H9F6NO
and a molecular weight of 225.13 g/mol. Its IUPAC name is 3-methoxy-N,N-bis(trifluoromethyl)propan-1-amine.
Molecular Properties
| Compound Name | 3-methoxy-N,N-bis(trifluoromethyl)propan-1-amine |
| PubChem CID | 59366578 |
| Molecular Formula | C6H9F6NO |
| Molecular Weight | 225.13 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-methoxy-N,N-bis(trifluoromethyl)propan-1-amine |
| SMILES | COCCCN(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H9F6NO/c1-14-4-2-3-13(5(7,8)9)6(10,11)12/h2-4H2,1H3 |
| InChIKey | LBGCAMJTIQKMDY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.13 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-N,N-bis(trifluoromethyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N,N-bis(trifluoromethyl)propan-1-amine?
The IUPAC name of 3-methoxy-N,N-bis(trifluoromethyl)propan-1-amine (CID 59366578) is 3-methoxy-N,N-bis(trifluoromethyl)propan-1-amine.
What is the SMILES notation for 3-methoxy-N,N-bis(trifluoromethyl)propan-1-amine?
The canonical SMILES for 3-methoxy-N,N-bis(trifluoromethyl)propan-1-amine is COCCCN(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 3-methoxy-N,N-bis(trifluoromethyl)propan-1-amine?
The InChIKey is LBGCAMJTIQKMDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F6NO/c1-14-4-2-3-13(5(7,8)9)6(10,11)12/h2-4H2,1H3.
What are the key properties of 3-methoxy-N,N-bis(trifluoromethyl)propan-1-amine?
3-methoxy-N,N-bis(trifluoromethyl)propan-1-amine has a molecular weight of 225.13 g/mol, XLogP of 2.36, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N,N-bis(trifluoromethyl)propan-1-amine is sourced from PubChem (CID 59366578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).