C19H17F6N5O4S — CID 59367610
2-[5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 59367610) has the molecular formula C19H17F6N5O4S and a molecular weight of 525.43 g/mol. Its IUPAC name is 2-[5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59367610 |
| Molecular Formula | C19H17F6N5O4S |
| Molecular Weight | 525.43 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | 2-[5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CC3CN(S(=O)(=O)c4cc(C(F)(F)F)cc(C(F)(F)F)c4)CC3C2)nc1 |
| InChI | InChI=1S/C19H17F6N5O4S/c20-18(21,22)13-1-14(19(23,24)25)3-15(2-13)35(33,34)30-8-11-6-29(7-12(11)9-30)17-26-4-10(5-27-17)16(31)28-32/h1-5,11-12,32H,6-9H2,(H,28,31) |
| InChIKey | PGBUAHSKIIRDRA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|