C15H22ClNO3S — CID 59367770
3-[1-(2-chloro-6-methylphenyl)sulfonylpiperidin-2-yl]propan-1-ol (PubChem CID 59367770) has the molecular formula C15H22ClNO3S and a molecular weight of 331.86 g/mol. Its IUPAC name is 3-[1-(2-chloro-6-methylphenyl)sulfonylpiperidin-2-yl]propan-1-ol.
| Compound Name | 3-[1-(2-chloro-6-methylphenyl)sulfonylpiperidin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 59367770 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.86 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-[1-(2-chloro-6-methylphenyl)sulfonylpiperidin-2-yl]propan-1-ol |
| SMILES | Cc1cccc(Cl)c1S(=O)(=O)N1CCCCC1CCCO |
| InChI | InChI=1S/C15H22ClNO3S/c1-12-6-4-9-14(16)15(12)21(19,20)17-10-3-2-7-13(17)8-5-11-18/h4,6,9,13,18H,2-3,5,7-8,10-11H2,1H3 |
| InChIKey | IKBLDWRQJLRFDR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.86 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |