C18H23FN2O3 — CID 59367875
tert-butyl 4-[(4-fluorophenyl)-hydroxymethyl]-4-isocyanopiperidine-1-carboxylate (PubChem CID 59367875) has the molecular formula C18H23FN2O3 and a molecular weight of 334.39 g/mol. Its IUPAC name is tert-butyl 4-[(4-fluorophenyl)-hydroxymethyl]-4-isocyanopiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-fluorophenyl)-hydroxymethyl]-4-isocyanopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 59367875 |
| Molecular Formula | C18H23FN2O3 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | tert-butyl 4-[(4-fluorophenyl)-hydroxymethyl]-4-isocyanopiperidine-1-carboxylate |
| SMILES | [C-]#[N+]C1(C(O)c2ccc(F)cc2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H23FN2O3/c1-17(2,3)24-16(23)21-11-9-18(20-4,10-12-21)15(22)13-5-7-14(19)8-6-13/h5-8,15,22H,9-12H2,1-3H3 |
| InChIKey | ZKLDWPBETFQEDY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|