C24H23ClFN3O5 — CID 59368066
[6-chloro-2-[4-cyano-4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-3,4-dihydro-2H-1,4-benzoxazin-7-yl]oxymethyl formate (PubChem CID 59368066) has the molecular formula C24H23ClFN3O5 and a molecular weight of 487.92 g/mol. Its IUPAC name is [6-chloro-2-[4-cyano-4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-3,4-dihydro-2H-1,4-benzoxazin-7-yl]oxymethyl formate.
| Compound Name | [6-chloro-2-[4-cyano-4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-3,4-dihydro-2H-1,4-benzoxazin-7-yl]oxymethyl formate |
|---|---|
| PubChem CID | 59368066 |
| Molecular Formula | C24H23ClFN3O5 |
| Molecular Weight | 487.92 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | [6-chloro-2-[4-cyano-4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-3,4-dihydro-2H-1,4-benzoxazin-7-yl]oxymethyl formate |
| SMILES | N#CC1(Cc2ccc(F)cc2)CCN(C(=O)C2CNc3cc(Cl)c(OCOC=O)cc3O2)CC1 |
| InChI | InChI=1S/C24H23ClFN3O5/c25-18-9-19-21(10-20(18)33-15-32-14-30)34-22(12-28-19)23(31)29-7-5-24(13-27,6-8-29)11-16-1-3-17(26)4-2-16/h1-4,9-10,14,22,28H,5-8,11-12,15H2 |
| InChIKey | ZRSIJACBEJMELR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.92 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|