C21H23ClN4 — CID 59368118
9-chloro-3-methyl-6-[2-(2-methylpyrimidin-5-yl)prop-2-enyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole (PubChem CID 59368118) has the molecular formula C21H23ClN4 and a molecular weight of 366.90 g/mol. Its IUPAC name is 9-chloro-3-methyl-6-[2-(2-methylpyrimidin-5-yl)prop-2-enyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole.
| Compound Name | 9-chloro-3-methyl-6-[2-(2-methylpyrimidin-5-yl)prop-2-enyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole |
|---|---|
| PubChem CID | 59368118 |
| Molecular Formula | C21H23ClN4 |
| Molecular Weight | 366.90 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 9-chloro-3-methyl-6-[2-(2-methylpyrimidin-5-yl)prop-2-enyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole |
| SMILES | C=C(Cn1c2c(c3cc(Cl)ccc31)CCN(C)CC2)c1cnc(C)nc1 |
| InChI | InChI=1S/C21H23ClN4/c1-14(16-11-23-15(2)24-12-16)13-26-20-5-4-17(22)10-19(20)18-6-8-25(3)9-7-21(18)26/h4-5,10-12H,1,6-9,13H2,2-3H3 |
| InChIKey | GJBUWJQVAROJPQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.90 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|