C20H22ClN3O — CID 59368152
2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-pyridin-4-ylethanol (PubChem CID 59368152) has the molecular formula C20H22ClN3O and a molecular weight of 355.87 g/mol. Its IUPAC name is 2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-pyridin-4-ylethanol.
| Compound Name | 2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 59368152 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-pyridin-4-ylethanol |
| SMILES | CN1CCc2c(n(CC(O)c3ccncc3)c3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C20H22ClN3O/c1-23-10-6-16-17-12-15(21)2-3-18(17)24(19(16)7-11-23)13-20(25)14-4-8-22-9-5-14/h2-5,8-9,12,20,25H,6-7,10-11,13H2,1H3 |
| InChIKey | JZPAJEWCLMFWOL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|