C24H29ClN2 — CID 59368214
9-chloro-3-methyl-6-[2-(4-propan-2-ylphenyl)ethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole (PubChem CID 59368214) has the molecular formula C24H29ClN2 and a molecular weight of 380.96 g/mol. Its IUPAC name is 9-chloro-3-methyl-6-[2-(4-propan-2-ylphenyl)ethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole.
| Compound Name | 9-chloro-3-methyl-6-[2-(4-propan-2-ylphenyl)ethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole |
|---|---|
| PubChem CID | 59368214 |
| Molecular Formula | C24H29ClN2 |
| Molecular Weight | 380.96 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 9-chloro-3-methyl-6-[2-(4-propan-2-ylphenyl)ethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole |
| SMILES | CC(C)c1ccc(CCn2c3c(c4cc(Cl)ccc42)CCN(C)CC3)cc1 |
| InChI | InChI=1S/C24H29ClN2/c1-17(2)19-6-4-18(5-7-19)10-15-27-23-9-8-20(25)16-22(23)21-11-13-26(3)14-12-24(21)27/h4-9,16-17H,10-15H2,1-3H3 |
| InChIKey | ZCMJNXSSVYVJQO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.96 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|