C22H30ClN3O — CID 59368346
2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-N-cyclohexyl-N-methylacetamide (PubChem CID 59368346) has the molecular formula C22H30ClN3O and a molecular weight of 387.96 g/mol. Its IUPAC name is 2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-N-cyclohexyl-N-methylacetamide.
| Compound Name | 2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-N-cyclohexyl-N-methylacetamide |
|---|---|
| PubChem CID | 59368346 |
| Molecular Formula | C22H30ClN3O |
| Molecular Weight | 387.96 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-N-cyclohexyl-N-methylacetamide |
| SMILES | CN1CCc2c(n(CC(=O)N(C)C3CCCCC3)c3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C22H30ClN3O/c1-24-12-10-18-19-14-16(23)8-9-20(19)26(21(18)11-13-24)15-22(27)25(2)17-6-4-3-5-7-17/h8-9,14,17H,3-7,10-13,15H2,1-2H3 |
| InChIKey | CHAGIGCIGINJQZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.96 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|