C21H21ClF3N3O — CID 59368446
2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-[6-(trifluoromethyl)-3-pyridinyl]ethanol (PubChem CID 59368446) has the molecular formula C21H21ClF3N3O and a molecular weight of 423.87 g/mol. Its IUPAC name is 2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-[6-(trifluoromethyl)-3-pyridinyl]ethanol.
| Compound Name | 2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-[6-(trifluoromethyl)-3-pyridinyl]ethanol |
|---|---|
| PubChem CID | 59368446 |
| Molecular Formula | C21H21ClF3N3O |
| Molecular Weight | 423.87 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-[6-(trifluoromethyl)-3-pyridinyl]ethanol |
| SMILES | CN1CCc2c(n(CC(O)c3ccc(C(F)(F)F)nc3)c3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C21H21ClF3N3O/c1-27-8-6-15-16-10-14(22)3-4-17(16)28(18(15)7-9-27)12-19(29)13-2-5-20(26-11-13)21(23,24)25/h2-5,10-11,19,29H,6-9,12H2,1H3 |
| InChIKey | QPJPQFOUQWOOBA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.87 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|