About (8-phenyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)methanol
(8-phenyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)methanol (PubChem CID 59368526) has the molecular formula C15H16N2O
and a molecular weight of 240.31 g/mol. Its IUPAC name is (8-phenyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)methanol.
Molecular Properties
| Compound Name | (8-phenyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)methanol |
| PubChem CID | 59368526 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (8-phenyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)methanol |
| SMILES | OCc1ccc2c(n1)N(c1ccccc1)CCC2 |
| InChI | InChI=1S/C15H16N2O/c18-11-13-9-8-12-5-4-10-17(15(12)16-13)14-6-2-1-3-7-14/h1-3,6-9,18H,4-5,10-11H2 |
| InChIKey | BQYFPQDEJLTKDJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (8-phenyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-phenyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)methanol?
The IUPAC name of (8-phenyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)methanol (CID 59368526) is (8-phenyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)methanol.
What is the SMILES notation for (8-phenyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)methanol?
The canonical SMILES for (8-phenyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)methanol is OCc1ccc2c(n1)N(c1ccccc1)CCC2.
What is the InChIKey of (8-phenyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)methanol?
The InChIKey is BQYFPQDEJLTKDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O/c18-11-13-9-8-12-5-4-10-17(15(12)16-13)14-6-2-1-3-7-14/h1-3,6-9,18H,4-5,10-11H2.
What are the key properties of (8-phenyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)methanol?
(8-phenyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)methanol has a molecular weight of 240.31 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8-phenyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)methanol is sourced from PubChem (CID 59368526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).