About 7-(dimethoxymethyl)-1-(4-fluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine
7-(dimethoxymethyl)-1-(4-fluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine (PubChem CID 59368695) has the molecular formula C17H19FN2O2
and a molecular weight of 302.35 g/mol. Its IUPAC name is 7-(dimethoxymethyl)-1-(4-fluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine.
Molecular Properties
| Compound Name | 7-(dimethoxymethyl)-1-(4-fluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine |
| PubChem CID | 59368695 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 7-(dimethoxymethyl)-1-(4-fluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine |
| SMILES | COC(OC)c1ccc2c(n1)N(c1ccc(F)cc1)CCC2 |
| InChI | InChI=1S/C17H19FN2O2/c1-21-17(22-2)15-10-5-12-4-3-11-20(16(12)19-15)14-8-6-13(18)7-9-14/h5-10,17H,3-4,11H2,1-2H3 |
| InChIKey | IYNGGYWKUIUJHH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 7-(dimethoxymethyl)-1-(4-fluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(dimethoxymethyl)-1-(4-fluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine?
The IUPAC name of 7-(dimethoxymethyl)-1-(4-fluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine (CID 59368695) is 7-(dimethoxymethyl)-1-(4-fluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine.
What is the SMILES notation for 7-(dimethoxymethyl)-1-(4-fluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine?
The canonical SMILES for 7-(dimethoxymethyl)-1-(4-fluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine is COC(OC)c1ccc2c(n1)N(c1ccc(F)cc1)CCC2.
What is the InChIKey of 7-(dimethoxymethyl)-1-(4-fluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine?
The InChIKey is IYNGGYWKUIUJHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19FN2O2/c1-21-17(22-2)15-10-5-12-4-3-11-20(16(12)19-15)14-8-6-13(18)7-9-14/h5-10,17H,3-4,11H2,1-2H3.
What are the key properties of 7-(dimethoxymethyl)-1-(4-fluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine?
7-(dimethoxymethyl)-1-(4-fluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine has a molecular weight of 302.35 g/mol, XLogP of 3.60, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(dimethoxymethyl)-1-(4-fluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine is sourced from PubChem (CID 59368695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).