C17H17F3N2O2 — CID 59368970
7-(dimethoxymethyl)-1-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine (PubChem CID 59368970) has the molecular formula C17H17F3N2O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is 7-(dimethoxymethyl)-1-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine.
| Compound Name | 7-(dimethoxymethyl)-1-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine |
|---|---|
| PubChem CID | 59368970 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 7-(dimethoxymethyl)-1-(3,4,5-trifluorophenyl)-3,4-dihydro-2H-1,8-naphthyridine |
| SMILES | COC(OC)c1ccc2c(n1)N(c1cc(F)c(F)c(F)c1)CCC2 |
| InChI | InChI=1S/C17H17F3N2O2/c1-23-17(24-2)14-6-5-10-4-3-7-22(16(10)21-14)11-8-12(18)15(20)13(19)9-11/h5-6,8-9,17H,3-4,7H2,1-2H3 |
| InChIKey | VSPLMOSXOFWEJZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|