C17H18F2N2O2 — CID 59369324
1-(3,4-difluorophenyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine (PubChem CID 59369324) has the molecular formula C17H18F2N2O2 and a molecular weight of 320.34 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine.
| Compound Name | 1-(3,4-difluorophenyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine |
|---|---|
| PubChem CID | 59369324 |
| Molecular Formula | C17H18F2N2O2 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-(3,4-difluorophenyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine |
| SMILES | COC(OC)c1ccc2c(n1)N(c1ccc(F)c(F)c1)CCC2 |
| InChI | InChI=1S/C17H18F2N2O2/c1-22-17(23-2)15-8-5-11-4-3-9-21(16(11)20-15)12-6-7-13(18)14(19)10-12/h5-8,10,17H,3-4,9H2,1-2H3 |
| InChIKey | DJIKYAJDNANZKP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|