About CID 59369503
CID 59369503 (PubChem CID 59369503) has the molecular formula C9H9F2NOS
and a molecular weight of 217.24 g/mol.
Molecular Properties
| Compound Name | CID 59369503 |
| PubChem CID | 59369503 |
| Molecular Formula | C9H9F2NOS |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | — |
| SMILES | [CH]c1csc(C(=O)N(C)CC(F)F)c1 |
| InChI | InChI=1S/C9H9F2NOS/c1-6-3-7(14-5-6)9(13)12(2)4-8(10)11/h1,3,5,8H,4H2,2H3 |
| InChIKey | SPFWCSXEGSYIOA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59369503 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59369503?
The IUPAC name of CID 59369503 (CID 59369503) is not available.
What is the SMILES notation for CID 59369503?
The canonical SMILES for CID 59369503 is [CH]c1csc(C(=O)N(C)CC(F)F)c1.
What is the InChIKey of CID 59369503?
The InChIKey is SPFWCSXEGSYIOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NOS/c1-6-3-7(14-5-6)9(13)12(2)4-8(10)11/h1,3,5,8H,4H2,2H3.
What are the key properties of CID 59369503?
CID 59369503 has a molecular weight of 217.24 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59369503 is sourced from PubChem (CID 59369503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).