C10H14BrF — CID 59369637
4-bromo-1-tert-butyl-5-fluorocyclohexa-1,3-diene (PubChem CID 59369637) has the molecular formula C10H14BrF and a molecular weight of 233.12 g/mol. Its IUPAC name is 4-bromo-1-tert-butyl-5-fluorocyclohexa-1,3-diene.
| Compound Name | 4-bromo-1-tert-butyl-5-fluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 59369637 |
| Molecular Formula | C10H14BrF |
| Molecular Weight | 233.12 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 4-bromo-1-tert-butyl-5-fluorocyclohexa-1,3-diene |
| SMILES | CC(C)(C)C1=CC=C(Br)C(F)C1 |
| InChI | InChI=1S/C10H14BrF/c1-10(2,3)7-4-5-8(11)9(12)6-7/h4-5,9H,6H2,1-3H3 |
| InChIKey | ZXBJKMGLPIYIPO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.12 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |