C19H16ClN3O2S — CID 59369678
N-benzyl-2-[(4-chlorobenzoyl)amino]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 59369678) has the molecular formula C19H16ClN3O2S and a molecular weight of 385.88 g/mol. Its IUPAC name is N-benzyl-2-[(4-chlorobenzoyl)amino]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-benzyl-2-[(4-chlorobenzoyl)amino]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 59369678 |
| Molecular Formula | C19H16ClN3O2S |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-benzyl-2-[(4-chlorobenzoyl)amino]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(NC(=O)c2ccc(Cl)cc2)sc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H16ClN3O2S/c1-12-16(18(25)21-11-13-5-3-2-4-6-13)26-19(22-12)23-17(24)14-7-9-15(20)10-8-14/h2-10H,11H2,1H3,(H,21,25)(H,22,23,24) |
| InChIKey | KIYWQSVKWCLYKS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |