C19H21N3O5S — CID 59369722
thiophen-2-ylmethyl N-[[4-[(2S)-2-(hydroxycarbamoyl)pyrrolidine-1-carbonyl]phenyl]methyl]carbamate (PubChem CID 59369722) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is thiophen-2-ylmethyl N-[[4-[(2S)-2-(hydroxycarbamoyl)pyrrolidine-1-carbonyl]phenyl]methyl]carbamate.
| Compound Name | thiophen-2-ylmethyl N-[[4-[(2S)-2-(hydroxycarbamoyl)pyrrolidine-1-carbonyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 59369722 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | thiophen-2-ylmethyl N-[[4-[(2S)-2-(hydroxycarbamoyl)pyrrolidine-1-carbonyl]phenyl]methyl]carbamate |
| SMILES | O=C(NCc1ccc(C(=O)N2CCC[C@H]2C(=O)NO)cc1)OCc1cccs1 |
| InChI | InChI=1S/C19H21N3O5S/c23-17(21-26)16-4-1-9-22(16)18(24)14-7-5-13(6-8-14)11-20-19(25)27-12-15-3-2-10-28-15/h2-3,5-8,10,16,26H,1,4,9,11-12H2,(H,20,25)(H,21,23)/t16-/m0/s1 |
| InChIKey | MLXDZUYNLFNPLH-INIZCTEOSA-N |
| XLogP | 2.28 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|