C8H11N3O2 — CID 59370298
4,6-dimethyl-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidine-2,5-dione (PubChem CID 59370298) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 4,6-dimethyl-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidine-2,5-dione.
| Compound Name | 4,6-dimethyl-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 59370298 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 4,6-dimethyl-1,3,4,7-tetrahydropyrrolo[3,4-d]pyrimidine-2,5-dione |
| SMILES | CC1NC(=O)NC2=C1C(=O)N(C)C2 |
| InChI | InChI=1S/C8H11N3O2/c1-4-6-5(10-8(13)9-4)3-11(2)7(6)12/h4H,3H2,1-2H3,(H2,9,10,13) |
| InChIKey | QXOKXFRCEXQCFI-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |