C12H11F3N2O2 — CID 59370424
5-methyl-5-phenyl-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione (PubChem CID 59370424) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is 5-methyl-5-phenyl-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-phenyl-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59370424 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 5-methyl-5-phenyl-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione |
| SMILES | CC1(c2ccccc2)NC(=O)N(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C12H11F3N2O2/c1-11(8-5-3-2-4-6-8)9(18)17(10(19)16-11)7-12(13,14)15/h2-6H,7H2,1H3,(H,16,19) |
| InChIKey | GOLGTDOGTGGBEW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|