About 2-[(6S)-2,4-dioxo-6-phenyl-3-propan-2-yl-1,3-diazinan-1-yl]acetic acid
2-[(6S)-2,4-dioxo-6-phenyl-3-propan-2-yl-1,3-diazinan-1-yl]acetic acid (PubChem CID 59370448) has the molecular formula C15H18N2O4
and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[(6S)-2,4-dioxo-6-phenyl-3-propan-2-yl-1,3-diazinan-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(6S)-2,4-dioxo-6-phenyl-3-propan-2-yl-1,3-diazinan-1-yl]acetic acid |
| PubChem CID | 59370448 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[(6S)-2,4-dioxo-6-phenyl-3-propan-2-yl-1,3-diazinan-1-yl]acetic acid |
| SMILES | CC(C)N1C(=O)C[C@@H](c2ccccc2)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C15H18N2O4/c1-10(2)17-13(18)8-12(11-6-4-3-5-7-11)16(15(17)21)9-14(19)20/h3-7,10,12H,8-9H2,1-2H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | OBGNSWQCSBRDMT-LBPRGKRZSA-N |
| XLogP | 1.88 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(6S)-2,4-dioxo-6-phenyl-3-propan-2-yl-1,3-diazinan-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6S)-2,4-dioxo-6-phenyl-3-propan-2-yl-1,3-diazinan-1-yl]acetic acid?
The IUPAC name of 2-[(6S)-2,4-dioxo-6-phenyl-3-propan-2-yl-1,3-diazinan-1-yl]acetic acid (CID 59370448) is 2-[(6S)-2,4-dioxo-6-phenyl-3-propan-2-yl-1,3-diazinan-1-yl]acetic acid.
What is the SMILES notation for 2-[(6S)-2,4-dioxo-6-phenyl-3-propan-2-yl-1,3-diazinan-1-yl]acetic acid?
The canonical SMILES for 2-[(6S)-2,4-dioxo-6-phenyl-3-propan-2-yl-1,3-diazinan-1-yl]acetic acid is CC(C)N1C(=O)C[C@@H](c2ccccc2)N(CC(=O)O)C1=O.
What is the InChIKey of 2-[(6S)-2,4-dioxo-6-phenyl-3-propan-2-yl-1,3-diazinan-1-yl]acetic acid?
The InChIKey is OBGNSWQCSBRDMT-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H18N2O4/c1-10(2)17-13(18)8-12(11-6-4-3-5-7-11)16(15(17)21)9-14(19)20/h3-7,10,12H,8-9H2,1-2H3,(H,19,20)/t12-/m0/s1.
What are the key properties of 2-[(6S)-2,4-dioxo-6-phenyl-3-propan-2-yl-1,3-diazinan-1-yl]acetic acid?
2-[(6S)-2,4-dioxo-6-phenyl-3-propan-2-yl-1,3-diazinan-1-yl]acetic acid has a molecular weight of 290.32 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6S)-2,4-dioxo-6-phenyl-3-propan-2-yl-1,3-diazinan-1-yl]acetic acid is sourced from PubChem (CID 59370448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).