C16H14N2O3S — CID 59370610
5-oxo-3-phenyl-N-(2-thiophen-2-ylethyl)-1,2-oxazole-2-carboxamide (PubChem CID 59370610) has the molecular formula C16H14N2O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is 5-oxo-3-phenyl-N-(2-thiophen-2-ylethyl)-1,2-oxazole-2-carboxamide.
| Compound Name | 5-oxo-3-phenyl-N-(2-thiophen-2-ylethyl)-1,2-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 59370610 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 5-oxo-3-phenyl-N-(2-thiophen-2-ylethyl)-1,2-oxazole-2-carboxamide |
| SMILES | O=C(NCCc1cccs1)n1oc(=O)cc1-c1ccccc1 |
| InChI | InChI=1S/C16H14N2O3S/c19-15-11-14(12-5-2-1-3-6-12)18(21-15)16(20)17-9-8-13-7-4-10-22-13/h1-7,10-11H,8-9H2,(H,17,20) |
| InChIKey | JOTOEIKDQSAEEZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |