C21H30O2 — CID 59370889
(6aR,10aR)-2,4,6a,7,7,8,8,10,10a-nonadeuterio-6,6-dimethyl-3-pentyl-9-(trideuteriomethyl)benzo[c]chromen-1-ol (PubChem CID 59370889) has the molecular formula C21H30O2 and a molecular weight of 326.54 g/mol. Its IUPAC name is (6aR,10aR)-2,4,6a,7,7,8,8,10,10a-nonadeuterio-6,6-dimethyl-3-pentyl-9-(trideuteriomethyl)benzo[c]chromen-1-ol.
| Compound Name | (6aR,10aR)-2,4,6a,7,7,8,8,10,10a-nonadeuterio-6,6-dimethyl-3-pentyl-9-(trideuteriomethyl)benzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 59370889 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 326.54 g/mol |
| Exact Mass | 326.30 |
| IUPAC Name | (6aR,10aR)-2,4,6a,7,7,8,8,10,10a-nonadeuterio-6,6-dimethyl-3-pentyl-9-(trideuteriomethyl)benzo[c]chromen-1-ol |
| SMILES | [2H]C1=C(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])[C@@]2([2H])C(C)(C)Oc3c([2H])c(CCCCC)c([2H])c(O)c3[C@]12[2H] |
| InChI | InChI=1S/C21H30O2/c1-5-6-7-8-15-12-18(22)20-16-11-14(2)9-10-17(16)21(3,4)23-19(20)13-15/h11-13,16-17,22H,5-10H2,1-4H3/t16-,17-/m1/s1/i2D3,9D2,10D2,11D,12D,13D,16D,17D |
| InChIKey | CYQFCXCEBYINGO-LQGUFAIUSA-N |
| XLogP | 5.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|