About (2,5-dichlorophenyl)-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]methanone
(2,5-dichlorophenyl)-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]methanone (PubChem CID 59370934) has the molecular formula C16H9Cl2NO3S2
and a molecular weight of 398.29 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]methanone.
Molecular Properties
| Compound Name | (2,5-dichlorophenyl)-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]methanone |
| PubChem CID | 59370934 |
| Molecular Formula | C16H9Cl2NO3S2 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 396.94 |
| IUPAC Name | (2,5-dichlorophenyl)-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)c2nccs2)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H9Cl2NO3S2/c17-11-3-6-14(18)13(9-11)15(20)10-1-4-12(5-2-10)24(21,22)16-19-7-8-23-16/h1-9H |
| InChIKey | OREITTSGTREJRM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2,5-dichlorophenyl)-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dichlorophenyl)-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]methanone?
The IUPAC name of (2,5-dichlorophenyl)-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]methanone (CID 59370934) is (2,5-dichlorophenyl)-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]methanone.
What is the SMILES notation for (2,5-dichlorophenyl)-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]methanone?
The canonical SMILES for (2,5-dichlorophenyl)-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]methanone is O=C(c1ccc(S(=O)(=O)c2nccs2)cc1)c1cc(Cl)ccc1Cl.
What is the InChIKey of (2,5-dichlorophenyl)-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]methanone?
The InChIKey is OREITTSGTREJRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9Cl2NO3S2/c17-11-3-6-14(18)13(9-11)15(20)10-1-4-12(5-2-10)24(21,22)16-19-7-8-23-16/h1-9H.
What are the key properties of (2,5-dichlorophenyl)-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]methanone?
(2,5-dichlorophenyl)-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]methanone has a molecular weight of 398.29 g/mol, XLogP of 4.51, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dichlorophenyl)-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]methanone is sourced from PubChem (CID 59370934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).