C16H9F7O5 — CID 59371033
[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl] 2-hydroxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate (PubChem CID 59371033) has the molecular formula C16H9F7O5 and a molecular weight of 414.23 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl] 2-hydroxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl] 2-hydroxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
|---|---|
| PubChem CID | 59371033 |
| Molecular Formula | C16H9F7O5 |
| Molecular Weight | 414.23 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl] 2-hydroxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
| SMILES | O=C(Oc1c(F)c(F)c(C(F)(F)F)c(F)c1F)C12CC3CC1C(OC2=O)C3O |
| InChI | InChI=1S/C16H9F7O5/c17-6-5(16(21,22)23)7(18)9(20)12(8(6)19)28-14(26)15-2-3-1-4(15)11(10(3)24)27-13(15)25/h3-4,10-11,24H,1-2H2 |
| InChIKey | SOTJQKVKUVRKRL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|