C20H18F6O6 — CID 59371047
1,1,1,3,3,3-hexafluoropropan-2-yl 2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate (PubChem CID 59371047) has the molecular formula C20H18F6O6 and a molecular weight of 468.35 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
|---|---|
| PubChem CID | 59371047 |
| Molecular Formula | C20H18F6O6 |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
| SMILES | O=C(OC1C2CC3C1OC(=O)C3(C(=O)OC(C(F)(F)F)C(F)(F)F)C2)C1CC2C=CC1C2 |
| InChI | InChI=1S/C20H18F6O6/c21-19(22,23)15(20(24,25)26)32-17(29)18-6-9-5-11(18)13(31-16(18)28)12(9)30-14(27)10-4-7-1-2-8(10)3-7/h1-2,7-13,15H,3-6H2 |
| InChIKey | NQEJFHJYIIBGPR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|