C36H34F6O8 — CID 59371078
1-O-[(4-ethenylphenyl)methyl] 2-O-[6-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)oxycarbonyl-9-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] cyclohexane-1,2-dicarboxylate (PubChem CID 59371078) has the molecular formula C36H34F6O8 and a molecular weight of 708.65 g/mol. Its IUPAC name is 1-O-[(4-ethenylphenyl)methyl] 2-O-[6-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)oxycarbonyl-9-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] cyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-[(4-ethenylphenyl)methyl] 2-O-[6-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)oxycarbonyl-9-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 59371078 |
| Molecular Formula | C36H34F6O8 |
| Molecular Weight | 708.65 g/mol |
| Exact Mass | 708.22 |
| IUPAC Name | 1-O-[(4-ethenylphenyl)methyl] 2-O-[6-(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)oxycarbonyl-9-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] cyclohexane-1,2-dicarboxylate |
| SMILES | C=Cc1ccc(COC(=O)C2CCCCC2C(=O)OC2C3CC4C2OC(=O)C4(C(=O)OC(c2ccccc2)(C(F)(F)F)C(F)(F)F)C3C)cc1 |
| InChI | InChI=1S/C36H34F6O8/c1-3-20-13-15-21(16-14-20)18-47-29(43)23-11-7-8-12-24(23)30(44)48-27-25-17-26-28(27)49-31(45)33(26,19(25)2)32(46)50-34(35(37,38)39,36(40,41)42)22-9-5-4-6-10-22/h3-6,9-10,13-16,19,23-28H,1,7-8,11-12,17-18H2,2H3 |
| InChIKey | DPVRKCDQEZXDCY-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.65 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|