About 1-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydropyrazine
1-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydropyrazine (PubChem CID 59371108) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydropyrazine.
Molecular Properties
| Compound Name | 1-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydropyrazine |
| PubChem CID | 59371108 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydropyrazine |
| SMILES | CC1=CC=C(N2C=CN(C)CC2)CC1 |
| InChI | InChI=1S/C12H18N2/c1-11-3-5-12(6-4-11)14-9-7-13(2)8-10-14/h3,5,7,9H,4,6,8,10H2,1-2H3 |
| InChIKey | KCDOLWIVAICDJG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydropyrazine?
The IUPAC name of 1-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydropyrazine (CID 59371108) is 1-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydropyrazine.
What is the SMILES notation for 1-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydropyrazine?
The canonical SMILES for 1-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydropyrazine is CC1=CC=C(N2C=CN(C)CC2)CC1.
What is the InChIKey of 1-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydropyrazine?
The InChIKey is KCDOLWIVAICDJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-11-3-5-12(6-4-11)14-9-7-13(2)8-10-14/h3,5,7,9H,4,6,8,10H2,1-2H3.
What are the key properties of 1-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydropyrazine?
1-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydropyrazine has a molecular weight of 190.29 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydropyrazine is sourced from PubChem (CID 59371108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).