About (E)-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enal
(E)-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enal (PubChem CID 59371790) has the molecular formula C20H36O3
and a molecular weight of 324.50 g/mol. Its IUPAC name is (E)-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enal.
Molecular Properties
| Compound Name | (E)-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enal |
| PubChem CID | 59371790 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | (E)-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enal |
| SMILES | CCCCCCCC1(CCCCCC/C=C/CC=O)OCCO1 |
| InChI | InChI=1S/C20H36O3/c1-2-3-4-9-12-15-20(22-18-19-23-20)16-13-10-7-5-6-8-11-14-17-21/h8,11,17H,2-7,9-10,12-16,18-19H2,1H3/b11-8+ |
| InChIKey | BGBVCGJVUYKQJC-DHZHZOJOSA-N |
| XLogP | 5.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enal?
The IUPAC name of (E)-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enal (CID 59371790) is (E)-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enal.
What is the SMILES notation for (E)-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enal?
The canonical SMILES for (E)-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enal is CCCCCCCC1(CCCCCC/C=C/CC=O)OCCO1.
What is the InChIKey of (E)-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enal?
The InChIKey is BGBVCGJVUYKQJC-DHZHZOJOSA-N. The full InChI is InChI=1S/C20H36O3/c1-2-3-4-9-12-15-20(22-18-19-23-20)16-13-10-7-5-6-8-11-14-17-21/h8,11,17H,2-7,9-10,12-16,18-19H2,1H3/b11-8+.
What are the key properties of (E)-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enal?
(E)-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enal has a molecular weight of 324.50 g/mol, XLogP of 5.58, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-enal is sourced from PubChem (CID 59371790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).