C27H29P — CID 59371899
(11R)-13-cyclopentyl-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2,4,6,8,16,18,22-octaene (PubChem CID 59371899) has the molecular formula C27H29P and a molecular weight of 384.50 g/mol. Its IUPAC name is (11R)-13-cyclopentyl-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2,4,6,8,16,18,22-octaene.
| Compound Name | (11R)-13-cyclopentyl-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2,4,6,8,16,18,22-octaene |
|---|---|
| PubChem CID | 59371899 |
| Molecular Formula | C27H29P |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (11R)-13-cyclopentyl-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2,4,6,8,16,18,22-octaene |
| SMILES | C1=c2ccccc2=C2c3c(ccc4c3=CCCC=4)CP(C3CCCC3)C[C@@H]2C1 |
| InChI | InChI=1S/C27H29P/c1-5-11-24-19(7-1)13-15-21-17-28(23-9-3-4-10-23)18-22-16-14-20-8-2-6-12-25(20)27(22)26(21)24/h1,5,7-8,11-14,16,21,23H,2-4,6,9-10,15,17-18H2/t21-,28?/m0/s1 |
| InChIKey | GRRPEWGUXVBPHW-QDLLFRBVSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|