About 5-bromo-2-methoxy-3-(2,2,2-trifluoroethyl)benzaldehyde
5-bromo-2-methoxy-3-(2,2,2-trifluoroethyl)benzaldehyde (PubChem CID 59372473) has the molecular formula C10H8BrF3O2
and a molecular weight of 297.07 g/mol. Its IUPAC name is 5-bromo-2-methoxy-3-(2,2,2-trifluoroethyl)benzaldehyde.
Molecular Properties
| Compound Name | 5-bromo-2-methoxy-3-(2,2,2-trifluoroethyl)benzaldehyde |
| PubChem CID | 59372473 |
| Molecular Formula | C10H8BrF3O2 |
| Molecular Weight | 297.07 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | 5-bromo-2-methoxy-3-(2,2,2-trifluoroethyl)benzaldehyde |
| SMILES | COc1c(C=O)cc(Br)cc1CC(F)(F)F |
| InChI | InChI=1S/C10H8BrF3O2/c1-16-9-6(4-10(12,13)14)2-8(11)3-7(9)5-15/h2-3,5H,4H2,1H3 |
| InChIKey | AGBXZTWMAFHSHB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.07 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-methoxy-3-(2,2,2-trifluoroethyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methoxy-3-(2,2,2-trifluoroethyl)benzaldehyde?
The IUPAC name of 5-bromo-2-methoxy-3-(2,2,2-trifluoroethyl)benzaldehyde (CID 59372473) is 5-bromo-2-methoxy-3-(2,2,2-trifluoroethyl)benzaldehyde.
What is the SMILES notation for 5-bromo-2-methoxy-3-(2,2,2-trifluoroethyl)benzaldehyde?
The canonical SMILES for 5-bromo-2-methoxy-3-(2,2,2-trifluoroethyl)benzaldehyde is COc1c(C=O)cc(Br)cc1CC(F)(F)F.
What is the InChIKey of 5-bromo-2-methoxy-3-(2,2,2-trifluoroethyl)benzaldehyde?
The InChIKey is AGBXZTWMAFHSHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrF3O2/c1-16-9-6(4-10(12,13)14)2-8(11)3-7(9)5-15/h2-3,5H,4H2,1H3.
What are the key properties of 5-bromo-2-methoxy-3-(2,2,2-trifluoroethyl)benzaldehyde?
5-bromo-2-methoxy-3-(2,2,2-trifluoroethyl)benzaldehyde has a molecular weight of 297.07 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methoxy-3-(2,2,2-trifluoroethyl)benzaldehyde is sourced from PubChem (CID 59372473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).