C20H23N4O2P — CID 59372570
4-N-(dimethylphosphoryloxymethyl)-5-methyl-2-N,4-N-diphenylpyrimidine-2,4-diamine (PubChem CID 59372570) has the molecular formula C20H23N4O2P and a molecular weight of 382.40 g/mol. Its IUPAC name is 4-N-(dimethylphosphoryloxymethyl)-5-methyl-2-N,4-N-diphenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(dimethylphosphoryloxymethyl)-5-methyl-2-N,4-N-diphenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 59372570 |
| Molecular Formula | C20H23N4O2P |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 4-N-(dimethylphosphoryloxymethyl)-5-methyl-2-N,4-N-diphenylpyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2ccccc2)nc1N(COP(C)(C)=O)c1ccccc1 |
| InChI | InChI=1S/C20H23N4O2P/c1-16-14-21-20(22-17-10-6-4-7-11-17)23-19(16)24(15-26-27(2,3)25)18-12-8-5-9-13-18/h4-14H,15H2,1-3H3,(H,21,22,23) |
| InChIKey | JIFPZZOIUQSVBI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|