C28H44O3Si — CID 59372847
(5R)-5-[(1E,3Z,6Z,9Z,11E,13S,15Z)-13-[tert-butyl(dimethyl)silyl]oxyoctadeca-1,3,6,9,11,15-hexaenyl]oxolan-2-one (PubChem CID 59372847) has the molecular formula C28H44O3Si and a molecular weight of 456.74 g/mol. Its IUPAC name is (5R)-5-[(1E,3Z,6Z,9Z,11E,13S,15Z)-13-[tert-butyl(dimethyl)silyl]oxyoctadeca-1,3,6,9,11,15-hexaenyl]oxolan-2-one.
| Compound Name | (5R)-5-[(1E,3Z,6Z,9Z,11E,13S,15Z)-13-[tert-butyl(dimethyl)silyl]oxyoctadeca-1,3,6,9,11,15-hexaenyl]oxolan-2-one |
|---|---|
| PubChem CID | 59372847 |
| Molecular Formula | C28H44O3Si |
| Molecular Weight | 456.74 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | (5R)-5-[(1E,3Z,6Z,9Z,11E,13S,15Z)-13-[tert-butyl(dimethyl)silyl]oxyoctadeca-1,3,6,9,11,15-hexaenyl]oxolan-2-one |
| SMILES | CC/C=C\C[C@@H](/C=C/C=C\C/C=C\C/C=C\C=C\[C@H]1CCC(=O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H44O3Si/c1-7-8-17-21-26(31-32(5,6)28(2,3)4)22-19-16-14-12-10-9-11-13-15-18-20-25-23-24-27(29)30-25/h8-10,13-20,22,25-26H,7,11-12,21,23-24H2,1-6H3/b10-9-,15-13-,16-14-,17-8-,20-18+,22-19+/t25-,26-/m0/s1 |
| InChIKey | YECZGXONUOSECF-HVJARBHQSA-N |
| XLogP | 8.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.74 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|