C16H29IO3Si — CID 59372870
methyl (4Z,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-9-iodonona-4,8-dienoate (PubChem CID 59372870) has the molecular formula C16H29IO3Si and a molecular weight of 424.40 g/mol. Its IUPAC name is methyl (4Z,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-9-iodonona-4,8-dienoate.
| Compound Name | methyl (4Z,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-9-iodonona-4,8-dienoate |
|---|---|
| PubChem CID | 59372870 |
| Molecular Formula | C16H29IO3Si |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | methyl (4Z,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-9-iodonona-4,8-dienoate |
| SMILES | COC(=O)CC/C=C\C[C@@H](/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H29IO3Si/c1-16(2,3)21(5,6)20-14(12-13-17)10-8-7-9-11-15(18)19-4/h7-8,12-14H,9-11H2,1-6H3/b8-7-,13-12+/t14-/m0/s1 |
| InChIKey | LHRLSNQGZBXJBZ-DRFZDECSSA-N |
| XLogP | 5.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|