C28H46O3Si — CID 59372883
(4Z,7Z,10Z,13Z,15E,17S,19Z)-17-[tert-butyl(dimethyl)silyl]oxydocosa-4,7,10,13,15,19-hexaenoic acid (PubChem CID 59372883) has the molecular formula C28H46O3Si and a molecular weight of 458.76 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,15E,17S,19Z)-17-[tert-butyl(dimethyl)silyl]oxydocosa-4,7,10,13,15,19-hexaenoic acid.
| Compound Name | (4Z,7Z,10Z,13Z,15E,17S,19Z)-17-[tert-butyl(dimethyl)silyl]oxydocosa-4,7,10,13,15,19-hexaenoic acid |
|---|---|
| PubChem CID | 59372883 |
| Molecular Formula | C28H46O3Si |
| Molecular Weight | 458.76 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | (4Z,7Z,10Z,13Z,15E,17S,19Z)-17-[tert-butyl(dimethyl)silyl]oxydocosa-4,7,10,13,15,19-hexaenoic acid |
| SMILES | CC/C=C\C[C@@H](/C=C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H46O3Si/c1-7-8-20-23-26(31-32(5,6)28(2,3)4)24-21-18-16-14-12-10-9-11-13-15-17-19-22-25-27(29)30/h8,10-13,16-21,24,26H,7,9,14-15,22-23,25H2,1-6H3,(H,29,30)/b12-10-,13-11-,18-16-,19-17-,20-8-,24-21+/t26-/m0/s1 |
| InChIKey | CWJLJDYCLUWKAG-OVFFFESDSA-N |
| XLogP | 8.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.76 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|