C34H60O3Si2 — CID 59372888
[tert-butyl(dimethyl)silyl] (4Z,7Z,10Z,13Z,15E,17S,19Z)-17-[tert-butyl(dimethyl)silyl]oxydocosa-4,7,10,13,15,19-hexaenoate (PubChem CID 59372888) has the molecular formula C34H60O3Si2 and a molecular weight of 573.02 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (4Z,7Z,10Z,13Z,15E,17S,19Z)-17-[tert-butyl(dimethyl)silyl]oxydocosa-4,7,10,13,15,19-hexaenoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (4Z,7Z,10Z,13Z,15E,17S,19Z)-17-[tert-butyl(dimethyl)silyl]oxydocosa-4,7,10,13,15,19-hexaenoate |
|---|---|
| PubChem CID | 59372888 |
| Molecular Formula | C34H60O3Si2 |
| Molecular Weight | 573.02 g/mol |
| Exact Mass | 572.41 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (4Z,7Z,10Z,13Z,15E,17S,19Z)-17-[tert-butyl(dimethyl)silyl]oxydocosa-4,7,10,13,15,19-hexaenoate |
| SMILES | CC/C=C\C[C@@H](/C=C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H60O3Si2/c1-12-13-25-28-31(36-38(8,9)33(2,3)4)29-26-23-21-19-17-15-14-16-18-20-22-24-27-30-32(35)37-39(10,11)34(5,6)7/h13,15-18,21-26,29,31H,12,14,19-20,27-28,30H2,1-11H3/b17-15-,18-16-,23-21-,24-22-,25-13-,29-26+/t31-/m0/s1 |
| InChIKey | QQPFSODZBSQWFO-XEOJQUOWSA-N |
| XLogP | 11.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.02 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|