C22H38OSi2 — CID 59372891
tert-butyl-dimethyl-[(3Z,6S,7E)-13-trimethylsilyltrideca-3,7-dien-9,12-diyn-6-yl]oxysilane (PubChem CID 59372891) has the molecular formula C22H38OSi2 and a molecular weight of 374.72 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3Z,6S,7E)-13-trimethylsilyltrideca-3,7-dien-9,12-diyn-6-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3Z,6S,7E)-13-trimethylsilyltrideca-3,7-dien-9,12-diyn-6-yl]oxysilane |
|---|---|
| PubChem CID | 59372891 |
| Molecular Formula | C22H38OSi2 |
| Molecular Weight | 374.72 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | tert-butyl-dimethyl-[(3Z,6S,7E)-13-trimethylsilyltrideca-3,7-dien-9,12-diyn-6-yl]oxysilane |
| SMILES | CC/C=C\C[C@@H](/C=C/C#CCC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38OSi2/c1-10-11-15-18-21(23-25(8,9)22(2,3)4)19-16-13-12-14-17-20-24(5,6)7/h11,15-16,19,21H,10,14,18H2,1-9H3/b15-11-,19-16+/t21-/m0/s1 |
| InChIKey | IZPAOYXSRDBTCD-LIZZJOBASA-N |
| XLogP | 6.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.72 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|