C35H58O4Si2 — CID 59372892
methyl (4Z,7S,8E,15E,17S,19Z)-7,17-bis[[tert-butyl(dimethyl)silyl]oxy]docosa-4,8,15,19-tetraen-10,13-diynoate (PubChem CID 59372892) has the molecular formula C35H58O4Si2 and a molecular weight of 599.02 g/mol. Its IUPAC name is methyl (4Z,7S,8E,15E,17S,19Z)-7,17-bis[[tert-butyl(dimethyl)silyl]oxy]docosa-4,8,15,19-tetraen-10,13-diynoate.
| Compound Name | methyl (4Z,7S,8E,15E,17S,19Z)-7,17-bis[[tert-butyl(dimethyl)silyl]oxy]docosa-4,8,15,19-tetraen-10,13-diynoate |
|---|---|
| PubChem CID | 59372892 |
| Molecular Formula | C35H58O4Si2 |
| Molecular Weight | 599.02 g/mol |
| Exact Mass | 598.39 |
| IUPAC Name | methyl (4Z,7S,8E,15E,17S,19Z)-7,17-bis[[tert-butyl(dimethyl)silyl]oxy]docosa-4,8,15,19-tetraen-10,13-diynoate |
| SMILES | CC/C=C\C[C@@H](/C=C/C#CCC#C/C=C/[C@H](C/C=C\CCC(=O)OC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H58O4Si2/c1-13-14-21-26-31(38-40(9,10)34(2,3)4)27-22-18-16-15-17-19-23-28-32(39-41(11,12)35(5,6)7)29-24-20-25-30-33(36)37-8/h14,20-24,27-28,31-32H,13,15,25-26,29-30H2,1-12H3/b21-14-,24-20-,27-22+,28-23+/t31-,32+/m0/s1 |
| InChIKey | NJEQBMQUSQLIRG-SCGCYSGESA-N |
| XLogP | 9.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.02 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|