C28H45IO3Si — CID 59372895
5-[(3Z,6Z,9Z,11E,13S,15Z)-13-[tert-butyl(dimethyl)silyl]oxy-1-iodooctadeca-3,6,9,11,15-pentaenyl]oxolan-2-one (PubChem CID 59372895) has the molecular formula C28H45IO3Si and a molecular weight of 584.66 g/mol. Its IUPAC name is 5-[(3Z,6Z,9Z,11E,13S,15Z)-13-[tert-butyl(dimethyl)silyl]oxy-1-iodooctadeca-3,6,9,11,15-pentaenyl]oxolan-2-one.
| Compound Name | 5-[(3Z,6Z,9Z,11E,13S,15Z)-13-[tert-butyl(dimethyl)silyl]oxy-1-iodooctadeca-3,6,9,11,15-pentaenyl]oxolan-2-one |
|---|---|
| PubChem CID | 59372895 |
| Molecular Formula | C28H45IO3Si |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 5-[(3Z,6Z,9Z,11E,13S,15Z)-13-[tert-butyl(dimethyl)silyl]oxy-1-iodooctadeca-3,6,9,11,15-pentaenyl]oxolan-2-one |
| SMILES | CC/C=C\C[C@@H](/C=C/C=C\C/C=C\C/C=C\CC(I)C1CCC(=O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H45IO3Si/c1-7-8-16-19-24(32-33(5,6)28(2,3)4)20-17-14-12-10-9-11-13-15-18-21-25(29)26-22-23-27(30)31-26/h8-9,11-12,14-18,20,24-26H,7,10,13,19,21-23H2,1-6H3/b11-9-,14-12-,16-8-,18-15-,20-17+/t24-,25?,26?/m0/s1 |
| InChIKey | KEMCQZZQDWLDPL-RORLZFDXSA-N |
| XLogP | 8.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|