C28H30N4O2 — CID 59373502
9-[1-(anthracene-9-carbonyl)piperidin-4-yl]-2-methyl-1,3,9-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 59373502) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 9-[1-(anthracene-9-carbonyl)piperidin-4-yl]-2-methyl-1,3,9-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 9-[1-(anthracene-9-carbonyl)piperidin-4-yl]-2-methyl-1,3,9-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 59373502 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 9-[1-(anthracene-9-carbonyl)piperidin-4-yl]-2-methyl-1,3,9-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CC1=NC2(CCCN(C3CCN(C(=O)c4c5ccccc5cc5ccccc45)CC3)C2)C(=O)N1 |
| InChI | InChI=1S/C28H30N4O2/c1-19-29-27(34)28(30-19)13-6-14-32(18-28)22-11-15-31(16-12-22)26(33)25-23-9-4-2-7-20(23)17-21-8-3-5-10-24(21)25/h2-5,7-10,17,22H,6,11-16,18H2,1H3,(H,29,30,34) |
| InChIKey | JLTXDVYXRYRRKJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|