C32H35F3N4O3 — CID 59373619
9-[1-(anthracene-9-carbonyl)piperidin-4-yl]-2-ethyl-3-methyl-6-(2,2,2-trifluoroacetyl)-2,6,9-triazaspiro[4.5]decan-1-one (PubChem CID 59373619) has the molecular formula C32H35F3N4O3 and a molecular weight of 580.65 g/mol. Its IUPAC name is 9-[1-(anthracene-9-carbonyl)piperidin-4-yl]-2-ethyl-3-methyl-6-(2,2,2-trifluoroacetyl)-2,6,9-triazaspiro[4.5]decan-1-one.
| Compound Name | 9-[1-(anthracene-9-carbonyl)piperidin-4-yl]-2-ethyl-3-methyl-6-(2,2,2-trifluoroacetyl)-2,6,9-triazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 59373619 |
| Molecular Formula | C32H35F3N4O3 |
| Molecular Weight | 580.65 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | 9-[1-(anthracene-9-carbonyl)piperidin-4-yl]-2-ethyl-3-methyl-6-(2,2,2-trifluoroacetyl)-2,6,9-triazaspiro[4.5]decan-1-one |
| SMILES | CCN1C(=O)C2(CC1C)CN(C1CCN(C(=O)c3c4ccccc4cc4ccccc34)CC1)CCN2C(=O)C(F)(F)F |
| InChI | InChI=1S/C32H35F3N4O3/c1-3-38-21(2)19-31(29(38)41)20-37(16-17-39(31)30(42)32(33,34)35)24-12-14-36(15-13-24)28(40)27-25-10-6-4-8-22(25)18-23-9-5-7-11-26(23)27/h4-11,18,21,24H,3,12-17,19-20H2,1-2H3 |
| InChIKey | KIURTONGIIHDSX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|