C14H24N4O2 — CID 59373658
3-ethyl-9-piperidin-4-yl-1,3,9-triazaspiro[4.5]decane-2,4-dione (PubChem CID 59373658) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-ethyl-9-piperidin-4-yl-1,3,9-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-ethyl-9-piperidin-4-yl-1,3,9-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 59373658 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 3-ethyl-9-piperidin-4-yl-1,3,9-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN1C(=O)NC2(CCCN(C3CCNCC3)C2)C1=O |
| InChI | InChI=1S/C14H24N4O2/c1-2-18-12(19)14(16-13(18)20)6-3-9-17(10-14)11-4-7-15-8-5-11/h11,15H,2-10H2,1H3,(H,16,20) |
| InChIKey | NKGJZISBHFAQRT-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|