C30H33ClN4O7 — CID 59373749
tert-butyl 6-[2-[benzyl-[(2R)-2-(4-chloro-3-nitrophenyl)-2-hydroxyethyl]amino]ethoxy]-3-methoxyindazole-1-carboxylate (PubChem CID 59373749) has the molecular formula C30H33ClN4O7 and a molecular weight of 597.07 g/mol. Its IUPAC name is tert-butyl 6-[2-[benzyl-[(2R)-2-(4-chloro-3-nitrophenyl)-2-hydroxyethyl]amino]ethoxy]-3-methoxyindazole-1-carboxylate.
| Compound Name | tert-butyl 6-[2-[benzyl-[(2R)-2-(4-chloro-3-nitrophenyl)-2-hydroxyethyl]amino]ethoxy]-3-methoxyindazole-1-carboxylate |
|---|---|
| PubChem CID | 59373749 |
| Molecular Formula | C30H33ClN4O7 |
| Molecular Weight | 597.07 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | tert-butyl 6-[2-[benzyl-[(2R)-2-(4-chloro-3-nitrophenyl)-2-hydroxyethyl]amino]ethoxy]-3-methoxyindazole-1-carboxylate |
| SMILES | COc1nn(C(=O)OC(C)(C)C)c2cc(OCCN(Cc3ccccc3)C[C@H](O)c3ccc(Cl)c([N+](=O)[O-])c3)ccc12 |
| InChI | InChI=1S/C30H33ClN4O7/c1-30(2,3)42-29(37)34-25-17-22(11-12-23(25)28(32-34)40-4)41-15-14-33(18-20-8-6-5-7-9-20)19-27(36)21-10-13-24(31)26(16-21)35(38)39/h5-13,16-17,27,36H,14-15,18-19H2,1-4H3/t27-/m0/s1 |
| InChIKey | QEMAACUQUUGATO-MHZLTWQESA-N |
| XLogP | 6.00 |
| TPSA | 129.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.07 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|