About 1-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,4-diazepan-1-yl]ethanone
1-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,4-diazepan-1-yl]ethanone (PubChem CID 59374097) has the molecular formula C22H24N6O2
and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,4-diazepan-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,4-diazepan-1-yl]ethanone |
| PubChem CID | 59374097 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(c2nccnc2Oc2ccc(Nc3ccccn3)cc2)CC1 |
| InChI | InChI=1S/C22H24N6O2/c1-17(29)27-13-4-14-28(16-15-27)21-22(25-12-11-24-21)30-19-8-6-18(7-9-19)26-20-5-2-3-10-23-20/h2-3,5-12H,4,13-16H2,1H3,(H,23,26) |
| InChIKey | SYUPKPLCMNYBDQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,4-diazepan-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,4-diazepan-1-yl]ethanone?
The IUPAC name of 1-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,4-diazepan-1-yl]ethanone (CID 59374097) is 1-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,4-diazepan-1-yl]ethanone.
What is the SMILES notation for 1-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,4-diazepan-1-yl]ethanone?
The canonical SMILES for 1-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,4-diazepan-1-yl]ethanone is CC(=O)N1CCCN(c2nccnc2Oc2ccc(Nc3ccccn3)cc2)CC1.
What is the InChIKey of 1-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,4-diazepan-1-yl]ethanone?
The InChIKey is SYUPKPLCMNYBDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N6O2/c1-17(29)27-13-4-14-28(16-15-27)21-22(25-12-11-24-21)30-19-8-6-18(7-9-19)26-20-5-2-3-10-23-20/h2-3,5-12H,4,13-16H2,1H3,(H,23,26).
What are the key properties of 1-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,4-diazepan-1-yl]ethanone?
1-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,4-diazepan-1-yl]ethanone has a molecular weight of 404.47 g/mol, XLogP of 3.47, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]-1,4-diazepan-1-yl]ethanone is sourced from PubChem (CID 59374097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).