C20H21N5O3 — CID 59374193
N-[(2S)-1-methoxypropan-2-yl]-3-[4-(pyridin-2-ylamino)phenoxy]pyrazine-2-carboxamide (PubChem CID 59374193) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[(2S)-1-methoxypropan-2-yl]-3-[4-(pyridin-2-ylamino)phenoxy]pyrazine-2-carboxamide.
| Compound Name | N-[(2S)-1-methoxypropan-2-yl]-3-[4-(pyridin-2-ylamino)phenoxy]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59374193 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[(2S)-1-methoxypropan-2-yl]-3-[4-(pyridin-2-ylamino)phenoxy]pyrazine-2-carboxamide |
| SMILES | COC[C@H](C)NC(=O)c1nccnc1Oc1ccc(Nc2ccccn2)cc1 |
| InChI | InChI=1S/C20H21N5O3/c1-14(13-27-2)24-19(26)18-20(23-12-11-22-18)28-16-8-6-15(7-9-16)25-17-5-3-4-10-21-17/h3-12,14H,13H2,1-2H3,(H,21,25)(H,24,26)/t14-/m0/s1 |
| InChIKey | QPUMYEPHCVMCRU-AWEZNQCLSA-N |
| XLogP | 3.17 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |