C19H18N4O3 — CID 59374271
N-(2-hydroxyethyl)-2-[4-(pyridin-2-ylamino)phenoxy]pyridine-3-carboxamide (PubChem CID 59374271) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[4-(pyridin-2-ylamino)phenoxy]pyridine-3-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-2-[4-(pyridin-2-ylamino)phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59374271 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[4-(pyridin-2-ylamino)phenoxy]pyridine-3-carboxamide |
| SMILES | O=C(NCCO)c1cccnc1Oc1ccc(Nc2ccccn2)cc1 |
| InChI | InChI=1S/C19H18N4O3/c24-13-12-21-18(25)16-4-3-11-22-19(16)26-15-8-6-14(7-9-15)23-17-5-1-2-10-20-17/h1-11,24H,12-13H2,(H,20,23)(H,21,25) |
| InChIKey | NWJQLGLLDBVYRV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |