C16H18F4N9O — CID 59374452
CID 59374452 (PubChem CID 59374452) has the molecular formula C16H18F4N9O and a molecular weight of 428.37 g/mol.
| Compound Name | CID 59374452 |
|---|---|
| PubChem CID | 59374452 |
| Molecular Formula | C16H18F4N9O |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | — |
| SMILES | [NH]c1nc(NC2CC2)nn1-c1ncc(F)c(N2CCC[C@@H]2C(=O)NCC(F)(F)F)n1 |
| InChI | InChI=1S/C16H18F4N9O/c17-9-6-22-15(29-13(21)26-14(27-29)24-8-3-4-8)25-11(9)28-5-1-2-10(28)12(30)23-7-16(18,19)20/h6,8,10,21H,1-5,7H2,(H,23,30)(H,24,27)/t10-/m1/s1 |
| InChIKey | KJCWPLAQLAKOBC-SNVBAGLBSA-N |
| XLogP | 1.33 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |