About 1-pyrrolidin-1-yltricyclo[3.3.1.03,7]nonan-3-amine
1-pyrrolidin-1-yltricyclo[3.3.1.03,7]nonan-3-amine (PubChem CID 59374967) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-pyrrolidin-1-yltricyclo[3.3.1.03,7]nonan-3-amine.
Molecular Properties
| Compound Name | 1-pyrrolidin-1-yltricyclo[3.3.1.03,7]nonan-3-amine |
| PubChem CID | 59374967 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-pyrrolidin-1-yltricyclo[3.3.1.03,7]nonan-3-amine |
| SMILES | NC12CC3CC1CC(N1CCCC1)(C3)C2 |
| InChI | InChI=1S/C13H22N2/c14-13-7-10-5-11(13)8-12(6-10,9-13)15-3-1-2-4-15/h10-11H,1-9,14H2 |
| InChIKey | XFUDTZIZTSACTF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-pyrrolidin-1-yltricyclo[3.3.1.03,7]nonan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrolidin-1-yltricyclo[3.3.1.03,7]nonan-3-amine?
The IUPAC name of 1-pyrrolidin-1-yltricyclo[3.3.1.03,7]nonan-3-amine (CID 59374967) is 1-pyrrolidin-1-yltricyclo[3.3.1.03,7]nonan-3-amine.
What is the SMILES notation for 1-pyrrolidin-1-yltricyclo[3.3.1.03,7]nonan-3-amine?
The canonical SMILES for 1-pyrrolidin-1-yltricyclo[3.3.1.03,7]nonan-3-amine is NC12CC3CC1CC(N1CCCC1)(C3)C2.
What is the InChIKey of 1-pyrrolidin-1-yltricyclo[3.3.1.03,7]nonan-3-amine?
The InChIKey is XFUDTZIZTSACTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2/c14-13-7-10-5-11(13)8-12(6-10,9-13)15-3-1-2-4-15/h10-11H,1-9,14H2.
What are the key properties of 1-pyrrolidin-1-yltricyclo[3.3.1.03,7]nonan-3-amine?
1-pyrrolidin-1-yltricyclo[3.3.1.03,7]nonan-3-amine has a molecular weight of 206.33 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrolidin-1-yltricyclo[3.3.1.03,7]nonan-3-amine is sourced from PubChem (CID 59374967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).