About 1-(isocyanomethyl)-N-phosphanyltricyclo[3.3.1.03,7]nonan-3-amine
1-(isocyanomethyl)-N-phosphanyltricyclo[3.3.1.03,7]nonan-3-amine (PubChem CID 59374975) has the molecular formula C11H17N2P
and a molecular weight of 208.24 g/mol. Its IUPAC name is 1-(isocyanomethyl)-N-phosphanyltricyclo[3.3.1.03,7]nonan-3-amine.
Molecular Properties
| Compound Name | 1-(isocyanomethyl)-N-phosphanyltricyclo[3.3.1.03,7]nonan-3-amine |
| PubChem CID | 59374975 |
| Molecular Formula | C11H17N2P |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1-(isocyanomethyl)-N-phosphanyltricyclo[3.3.1.03,7]nonan-3-amine |
| SMILES | [C-]#[N+]CC12CC3CC(C1)C(NP)(C3)C2 |
| InChI | InChI=1S/C11H17N2P/c1-12-7-10-3-8-2-9(5-10)11(4-8,6-10)13-14/h8-9,13H,2-7,14H2 |
| InChIKey | FWBWLCBBMPLTLJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 16.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-(isocyanomethyl)-N-phosphanyltricyclo[3.3.1.03,7]nonan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(isocyanomethyl)-N-phosphanyltricyclo[3.3.1.03,7]nonan-3-amine?
The IUPAC name of 1-(isocyanomethyl)-N-phosphanyltricyclo[3.3.1.03,7]nonan-3-amine (CID 59374975) is 1-(isocyanomethyl)-N-phosphanyltricyclo[3.3.1.03,7]nonan-3-amine.
What is the SMILES notation for 1-(isocyanomethyl)-N-phosphanyltricyclo[3.3.1.03,7]nonan-3-amine?
The canonical SMILES for 1-(isocyanomethyl)-N-phosphanyltricyclo[3.3.1.03,7]nonan-3-amine is [C-]#[N+]CC12CC3CC(C1)C(NP)(C3)C2.
What is the InChIKey of 1-(isocyanomethyl)-N-phosphanyltricyclo[3.3.1.03,7]nonan-3-amine?
The InChIKey is FWBWLCBBMPLTLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N2P/c1-12-7-10-3-8-2-9(5-10)11(4-8,6-10)13-14/h8-9,13H,2-7,14H2.
What are the key properties of 1-(isocyanomethyl)-N-phosphanyltricyclo[3.3.1.03,7]nonan-3-amine?
1-(isocyanomethyl)-N-phosphanyltricyclo[3.3.1.03,7]nonan-3-amine has a molecular weight of 208.24 g/mol, XLogP of 2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(isocyanomethyl)-N-phosphanyltricyclo[3.3.1.03,7]nonan-3-amine is sourced from PubChem (CID 59374975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).