C30H41NO5Si — CID 59375250
1-O-tert-butyl 5-O-methyl 4-(3-phenylphenyl)-3-(2-trimethylsilylethoxymethyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (PubChem CID 59375250) has the molecular formula C30H41NO5Si and a molecular weight of 523.75 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-methyl 4-(3-phenylphenyl)-3-(2-trimethylsilylethoxymethyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
| Compound Name | 1-O-tert-butyl 5-O-methyl 4-(3-phenylphenyl)-3-(2-trimethylsilylethoxymethyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 59375250 |
| Molecular Formula | C30H41NO5Si |
| Molecular Weight | 523.75 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 1-O-tert-butyl 5-O-methyl 4-(3-phenylphenyl)-3-(2-trimethylsilylethoxymethyl)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| SMILES | COC(=O)C1=C(c2cccc(-c3ccccc3)c2)C(COCC[Si](C)(C)C)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C30H41NO5Si/c1-30(2,3)36-29(33)31-19-25(21-35-16-17-37(5,6)7)27(26(20-31)28(32)34-4)24-15-11-14-23(18-24)22-12-9-8-10-13-22/h8-15,18,25H,16-17,19-21H2,1-7H3 |
| InChIKey | JNIKZLBMYAKLBB-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.75 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|